C30H58O3 — CID 173395322
2-hydroxyethyl 2-methylprop-2-enoate;octakis(prop-1-ene) (PubChem CID 173395322) has the molecular formula C30H58O3 and a molecular weight of 466.79 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;octakis(prop-1-ene).
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;octakis(prop-1-ene) |
|---|---|
| PubChem CID | 173395322 |
| Molecular Formula | C30H58O3 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.44 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;octakis(prop-1-ene) |
| SMILES | C=C(C)C(=O)OCCO.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC |
| InChI | InChI=1S/C6H10O3.8C3H6/c1-5(2)6(8)9-4-3-7;8*1-3-2/h7H,1,3-4H2,2H3;8*3H,1H2,2H3 |
| InChIKey | CLEYNVKVEGWFKO-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|