About 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial
2-hydroxyethyl 2-methylprop-2-enoate;pentanedial (PubChem CID 56841985) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial |
| PubChem CID | 56841985 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial |
| SMILES | C=C(C)C(=O)OCCO.O=CCCCC=O |
| InChI | InChI=1S/C6H10O3.C5H8O2/c1-5(2)6(8)9-4-3-7;6-4-2-1-3-5-7/h7H,1,3-4H2,2H3;4-5H,1-3H2 |
| InChIKey | JXCDTORYGUGXIJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial (CID 56841985) is 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial is C=C(C)C(=O)OCCO.O=CCCCC=O.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial?
The InChIKey is JXCDTORYGUGXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C5H8O2/c1-5(2)6(8)9-4-3-7;6-4-2-1-3-5-7/h7H,1,3-4H2,2H3;4-5H,1-3H2.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial?
2-hydroxyethyl 2-methylprop-2-enoate;pentanedial has a molecular weight of 230.26 g/mol, XLogP of 0.65, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;pentanedial is sourced from PubChem (CID 56841985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).