C21H30Br3N3O9 — CID 101380738
2-[3,5-bis[2-(2-bromo-2-methylpropanoyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 2-bromo-2-methylpropanoate (PubChem CID 101380738) has the molecular formula C21H30Br3N3O9 and a molecular weight of 708.19 g/mol. Its IUPAC name is 2-[3,5-bis[2-(2-bromo-2-methylpropanoyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[3,5-bis[2-(2-bromo-2-methylpropanoyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 101380738 |
| Molecular Formula | C21H30Br3N3O9 |
| Molecular Weight | 708.19 g/mol |
| Exact Mass | 704.95 |
| IUPAC Name | 2-[3,5-bis[2-(2-bromo-2-methylpropanoyl)oxyethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCn1c(=O)n(CCOC(=O)C(C)(C)Br)c(=O)n(CCOC(=O)C(C)(C)Br)c1=O |
| InChI | InChI=1S/C21H30Br3N3O9/c1-19(2,22)13(28)34-10-7-25-16(31)26(8-11-35-14(29)20(3,4)23)18(33)27(17(25)32)9-12-36-15(30)21(5,6)24/h7-12H2,1-6H3 |
| InChIKey | LIYACTYJZKIRRK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|