C9H19BrO3Si — CID 139211567
3-[hydroxy(dimethyl)silyl]propyl 2-bromo-2-methylpropanoate (PubChem CID 139211567) has the molecular formula C9H19BrO3Si and a molecular weight of 283.24 g/mol. Its IUPAC name is 3-[hydroxy(dimethyl)silyl]propyl 2-bromo-2-methylpropanoate.
| Compound Name | 3-[hydroxy(dimethyl)silyl]propyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 139211567 |
| Molecular Formula | C9H19BrO3Si |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-[hydroxy(dimethyl)silyl]propyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCC[Si](C)(C)O |
| InChI | InChI=1S/C9H19BrO3Si/c1-9(2,10)8(11)13-6-5-7-14(3,4)12/h12H,5-7H2,1-4H3 |
| InChIKey | DXUHHTWHJFUPRC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|