C16H39BrO5Si4 — CID 158260593
3-[dimethylsilyloxy-[[dimethyl(trimethylsilyloxy)silyl]methoxy]-methylsilyl]propyl 2-bromo-2-methylpropanoate (PubChem CID 158260593) has the molecular formula C16H39BrO5Si4 and a molecular weight of 503.73 g/mol. Its IUPAC name is 3-[dimethylsilyloxy-[[dimethyl(trimethylsilyloxy)silyl]methoxy]-methylsilyl]propyl 2-bromo-2-methylpropanoate.
| Compound Name | 3-[dimethylsilyloxy-[[dimethyl(trimethylsilyloxy)silyl]methoxy]-methylsilyl]propyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 158260593 |
| Molecular Formula | C16H39BrO5Si4 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 3-[dimethylsilyloxy-[[dimethyl(trimethylsilyloxy)silyl]methoxy]-methylsilyl]propyl 2-bromo-2-methylpropanoate |
| SMILES | C[SiH](C)O[Si](C)(CCCOC(=O)C(C)(C)Br)OC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H39BrO5Si4/c1-16(2,17)15(18)19-12-11-13-26(10,21-23(3)4)20-14-25(8,9)22-24(5,6)7/h23H,11-14H2,1-10H3 |
| InChIKey | SHKSZLHCJWODPQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|