C19H39Br2ClO4Si2 — CID 160691888
chloro(dimethyl)silane;prop-2-enyl 2-bromo-2-methylpropanoate;3-trimethylsilylpropyl 2-bromo-2-methylpropanoate (PubChem CID 160691888) has the molecular formula C19H39Br2ClO4Si2 and a molecular weight of 582.95 g/mol. Its IUPAC name is chloro(dimethyl)silane;prop-2-enyl 2-bromo-2-methylpropanoate;3-trimethylsilylpropyl 2-bromo-2-methylpropanoate.
| Compound Name | chloro(dimethyl)silane;prop-2-enyl 2-bromo-2-methylpropanoate;3-trimethylsilylpropyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 160691888 |
| Molecular Formula | C19H39Br2ClO4Si2 |
| Molecular Weight | 582.95 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | chloro(dimethyl)silane;prop-2-enyl 2-bromo-2-methylpropanoate;3-trimethylsilylpropyl 2-bromo-2-methylpropanoate |
| SMILES | C=CCOC(=O)C(C)(C)Br.CC(C)(Br)C(=O)OCCC[Si](C)(C)C.C[SiH](C)Cl |
| InChI | InChI=1S/C10H21BrO2Si.C7H11BrO2.C2H7ClSi/c1-10(2,11)9(12)13-7-6-8-14(3,4)5;1-4-5-10-6(9)7(2,3)8;1-4(2)3/h6-8H2,1-5H3;4H,1,5H2,2-3H3;4H,1-2H3 |
| InChIKey | RPMWXYKDYYPKGR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.95 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|