C18H34Cl2O4Si2 — CID 159014537
chloro(dimethyl)silane;3-[chloro(dimethyl)silyl]propyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate (PubChem CID 159014537) has the molecular formula C18H34Cl2O4Si2 and a molecular weight of 441.54 g/mol. Its IUPAC name is chloro(dimethyl)silane;3-[chloro(dimethyl)silyl]propyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate.
| Compound Name | chloro(dimethyl)silane;3-[chloro(dimethyl)silyl]propyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159014537 |
| Molecular Formula | C18H34Cl2O4Si2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | chloro(dimethyl)silane;3-[chloro(dimethyl)silyl]propyl 2-methylprop-2-enoate;prop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)Cl.C=CCOC(=O)C(=C)C.C[SiH](C)Cl |
| InChI | InChI=1S/C9H17ClO2Si.C7H10O2.C2H7ClSi/c1-8(2)9(11)12-6-5-7-13(3,4)10;1-4-5-9-7(8)6(2)3;1-4(2)3/h1,5-7H2,2-4H3;4H,1-2,5H2,3H3;4H,1-2H3 |
| InChIKey | JSXOVIRBEROVCW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|