C9H17O3Si2 — CID 19429806
CID 19429806 (PubChem CID 19429806) has the molecular formula C9H17O3Si2 and a molecular weight of 229.40 g/mol.
| Compound Name | CID 19429806 |
|---|---|
| PubChem CID | 19429806 |
| Molecular Formula | C9H17O3Si2 |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si] |
| InChI | InChI=1S/C9H17O3Si2/c1-8(2)9(10)11-6-5-7-14(3,4)12-13/h1,5-7H2,2-4H3 |
| InChIKey | YXLTXRPXMWKNRK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|