C16H30O5Si2 — CID 123158447
3-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate (PubChem CID 123158447) has the molecular formula C16H30O5Si2 and a molecular weight of 358.58 g/mol. Its IUPAC name is 3-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123158447 |
| Molecular Formula | C16H30O5Si2 |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]O[Si](C)(C)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C16H30O5Si2/c1-13(2)15(17)19-9-7-11-22-21-23(5,6)12-8-10-20-16(18)14(3)4/h1,3,7-12,22H2,2,4-6H3 |
| InChIKey | ZJARELIAPWOJRB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|