C22H58O6Si8 — CID 123191425
3-[2-[2-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylethyl-dimethylsilyl]oxysilylethyl-dimethylsilyl]oxysilylpropyl 2-methylprop-2-enoate (PubChem CID 123191425) has the molecular formula C22H58O6Si8 and a molecular weight of 643.39 g/mol. Its IUPAC name is 3-[2-[2-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylethyl-dimethylsilyl]oxysilylethyl-dimethylsilyl]oxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[2-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylethyl-dimethylsilyl]oxysilylethyl-dimethylsilyl]oxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123191425 |
| Molecular Formula | C22H58O6Si8 |
| Molecular Weight | 643.39 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 3-[2-[2-[dimethyl(2-trimethylsilyloxysilylethyl)silyl]oxysilylethyl-dimethylsilyl]oxysilylethyl-dimethylsilyl]oxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]O[Si](C)(C)CC[SiH2]O[Si](C)(C)CC[SiH2]O[Si](C)(C)CC[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C22H58O6Si8/c1-21(2)22(23)24-13-12-14-29-26-34(6,7)19-16-31-28-36(10,11)20-17-32-27-35(8,9)18-15-30-25-33(3,4)5/h1,12-20,29-32H2,2-11H3 |
| InChIKey | UCSDECOQVZFVOQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|