C13H26O3Si — CID 86065689
6-trimethylsilyloxyhexyl 2-methylprop-2-enoate (PubChem CID 86065689) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is 6-trimethylsilyloxyhexyl 2-methylprop-2-enoate.
| Compound Name | 6-trimethylsilyloxyhexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86065689 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 6-trimethylsilyloxyhexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCO[Si](C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-12(2)13(14)15-10-8-6-7-9-11-16-17(3,4)5/h1,6-11H2,2-5H3 |
| InChIKey | IJPZFPCMPQPHSS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|