C20H40O7Si2 — CID 87862843
3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate (PubChem CID 87862843) has the molecular formula C20H40O7Si2 and a molecular weight of 448.71 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87862843 |
| Molecular Formula | C20H40O7Si2 |
| Molecular Weight | 448.71 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)OC.C=C(C)C(=O)OCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C10H20O4Si.C10H20O3Si/c1-9(2)10(11)14-7-6-8-15(5,12-3)13-4;1-9(2)10(11)13-7-6-8-14(4,5)12-3/h1,6-8H2,2-5H3;1,6-8H2,2-5H3 |
| InChIKey | CIGAURGYSFPCMG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|