C21H42O9Si2 — CID 87696910
3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;(2-methyl-3-trimethoxysilylpropyl) 2-methylprop-2-enoate (PubChem CID 87696910) has the molecular formula C21H42O9Si2 and a molecular weight of 494.73 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;(2-methyl-3-trimethoxysilylpropyl) 2-methylprop-2-enoate.
| Compound Name | 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;(2-methyl-3-trimethoxysilylpropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87696910 |
| Molecular Formula | C21H42O9Si2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;(2-methyl-3-trimethoxysilylpropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)C[Si](OC)(OC)OC.C=C(C)C(=O)OCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C11H22O5Si.C10H20O4Si/c1-9(2)11(12)16-7-10(3)8-17(13-4,14-5)15-6;1-9(2)10(11)14-7-6-8-15(5,12-3)13-4/h10H,1,7-8H2,2-6H3;1,6-8H2,2-5H3 |
| InChIKey | SFPHWBRNVKNTQS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|