About propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate
propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 174868664) has the molecular formula C13H28O5SSi
and a molecular weight of 324.52 g/mol. Its IUPAC name is propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| PubChem CID | 174868664 |
| Molecular Formula | C13H28O5SSi |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC)(OC)OC.CCCS |
| InChI | InChI=1S/C10H20O5Si.C3H8S/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-2-3-4/h1,6-8H2,2-5H3;4H,2-3H2,1H3 |
| InChIKey | RPUJKCYEMNAXCB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The IUPAC name of propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate (CID 174868664) is propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
What is the SMILES notation for propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The canonical SMILES for propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC[Si](OC)(OC)OC.CCCS.
What is the InChIKey of propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The InChIKey is RPUJKCYEMNAXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si.C3H8S/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-2-3-4/h1,6-8H2,2-5H3;4H,2-3H2,1H3.
What are the key properties of propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate has a molecular weight of 324.52 g/mol, XLogP of 2.70, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-thiol;3-trimethoxysilylpropyl 2-methylprop-2-enoate is sourced from PubChem (CID 174868664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).