C9H18O4Si — CID 140965642
3-(hydroxy-methoxy-methylsilyl)propyl 2-methylprop-2-enoate (PubChem CID 140965642) has the molecular formula C9H18O4Si and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-(hydroxy-methoxy-methylsilyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(hydroxy-methoxy-methylsilyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140965642 |
| Molecular Formula | C9H18O4Si |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-(hydroxy-methoxy-methylsilyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(O)OC |
| InChI | InChI=1S/C9H18O4Si/c1-8(2)9(10)13-6-5-7-14(4,11)12-3/h11H,1,5-7H2,2-4H3 |
| InChIKey | LUUJYQAHPPSAHL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|