C14H30O3Si2 — CID 140912977
3-[2-[methoxy(dimethyl)silyl]ethyl-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 140912977) has the molecular formula C14H30O3Si2 and a molecular weight of 302.56 g/mol. Its IUPAC name is 3-[2-[methoxy(dimethyl)silyl]ethyl-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[methoxy(dimethyl)silyl]ethyl-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140912977 |
| Molecular Formula | C14H30O3Si2 |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-[2-[methoxy(dimethyl)silyl]ethyl-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)CC[Si](C)(C)OC |
| InChI | InChI=1S/C14H30O3Si2/c1-13(2)14(15)17-9-8-10-18(4,5)11-12-19(6,7)16-3/h1,8-12H2,2-7H3 |
| InChIKey | DLTCXIJINXQQLF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|