C22H46O5Si2 — CID 139645621
3-[3-[3-[2-(2-methoxyethoxy)ethoxy]propyl-dimethylsilyl]propyl-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 139645621) has the molecular formula C22H46O5Si2 and a molecular weight of 446.78 g/mol. Its IUPAC name is 3-[3-[3-[2-(2-methoxyethoxy)ethoxy]propyl-dimethylsilyl]propyl-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-[3-[2-(2-methoxyethoxy)ethoxy]propyl-dimethylsilyl]propyl-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139645621 |
| Molecular Formula | C22H46O5Si2 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 3-[3-[3-[2-(2-methoxyethoxy)ethoxy]propyl-dimethylsilyl]propyl-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)CCC[Si](C)(C)CCCOCCOCCOC |
| InChI | InChI=1S/C22H46O5Si2/c1-21(2)22(23)27-12-9-18-29(6,7)20-10-19-28(4,5)17-8-11-25-15-16-26-14-13-24-3/h1,8-20H2,2-7H3 |
| InChIKey | FGIDANFBTZTKHI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|