About 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate
4-triethoxysilylbutyl 2-bromo-2-methylpropanoate (PubChem CID 71424824) has the molecular formula C14H29BrO5Si
and a molecular weight of 385.37 g/mol. Its IUPAC name is 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate |
| PubChem CID | 71424824 |
| Molecular Formula | C14H29BrO5Si |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate |
| SMILES | CCO[Si](CCCCOC(=O)C(C)(C)Br)(OCC)OCC |
| InChI | InChI=1S/C14H29BrO5Si/c1-6-18-21(19-7-2,20-8-3)12-10-9-11-17-13(16)14(4,5)15/h6-12H2,1-5H3 |
| InChIKey | RIFVNKPIAVCMKW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate?
The IUPAC name of 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate (CID 71424824) is 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate.
What is the SMILES notation for 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate?
The canonical SMILES for 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate is CCO[Si](CCCCOC(=O)C(C)(C)Br)(OCC)OCC.
What is the InChIKey of 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate?
The InChIKey is RIFVNKPIAVCMKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29BrO5Si/c1-6-18-21(19-7-2,20-8-3)12-10-9-11-17-13(16)14(4,5)15/h6-12H2,1-5H3.
What are the key properties of 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate?
4-triethoxysilylbutyl 2-bromo-2-methylpropanoate has a molecular weight of 385.37 g/mol, XLogP of 3.53, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triethoxysilylbutyl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 71424824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).