C45H81N3O9S3 — CID 139909149
2-[2,4,6-trioxo-3,5-bis[2-[2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoate (PubChem CID 139909149) has the molecular formula C45H81N3O9S3 and a molecular weight of 904.36 g/mol. Its IUPAC name is 2-[2,4,6-trioxo-3,5-bis[2-[2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoate.
| Compound Name | 2-[2,4,6-trioxo-3,5-bis[2-[2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 139909149 |
| Molecular Formula | C45H81N3O9S3 |
| Molecular Weight | 904.36 g/mol |
| Exact Mass | 903.51 |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis[2-[2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(2,4,4-trimethylpentan-2-ylsulfanyl)butanoate |
| SMILES | CCC(SC(C)(C)CC(C)(C)C)C(=O)OCCn1c(=O)n(CCOC(=O)C(CC)SC(C)(C)CC(C)(C)C)c(=O)n(CCOC(=O)C(CC)SC(C)(C)CC(C)(C)C)c1=O |
| InChI | InChI=1S/C45H81N3O9S3/c1-19-31(58-43(13,14)28-40(4,5)6)34(49)55-25-22-46-37(52)47(23-26-56-35(50)32(20-2)59-44(15,16)29-41(7,8)9)39(54)48(38(46)53)24-27-57-36(51)33(21-3)60-45(17,18)30-42(10,11)12/h31-33H,19-30H2,1-18H3 |
| InChIKey | RRCQFNOZUNLTJU-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.36 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|