C16H31NO4 — CID 139824188
2-[2-[2-(dipropylamino)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 139824188) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[2-[2-(dipropylamino)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(dipropylamino)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139824188 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 2-[2-[2-(dipropylamino)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCN(CCC)CCC |
| InChI | InChI=1S/C16H31NO4/c1-5-7-17(8-6-2)9-10-19-11-12-20-13-14-21-16(18)15(3)4/h3,5-14H2,1-2,4H3 |
| InChIKey | HZFWFROZBSJMOX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|