C15H29NO7S — CID 139973114
2-[2-[2-[2-[ethylsulfonyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 139973114) has the molecular formula C15H29NO7S and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-[2-[2-[2-[ethylsulfonyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-[ethylsulfonyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139973114 |
| Molecular Formula | C15H29NO7S |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[2-[2-[2-[ethylsulfonyl(methyl)amino]ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C15H29NO7S/c1-5-24(18,19)16(4)6-7-20-8-9-21-10-11-22-12-13-23-15(17)14(2)3/h2,5-13H2,1,3-4H3 |
| InChIKey | PMGWSXMXXQFVCZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|