C20H36N2O4 — CID 175332006
2-(dibutylamino)ethyl (4R)-4-amino-2-methyl-5-(2-methylprop-2-enoyloxy)pent-2-enoate (PubChem CID 175332006) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-(dibutylamino)ethyl (4R)-4-amino-2-methyl-5-(2-methylprop-2-enoyloxy)pent-2-enoate.
| Compound Name | 2-(dibutylamino)ethyl (4R)-4-amino-2-methyl-5-(2-methylprop-2-enoyloxy)pent-2-enoate |
|---|---|
| PubChem CID | 175332006 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-(dibutylamino)ethyl (4R)-4-amino-2-methyl-5-(2-methylprop-2-enoyloxy)pent-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@H](N)C=C(C)C(=O)OCCN(CCCC)CCCC |
| InChI | InChI=1S/C20H36N2O4/c1-6-8-10-22(11-9-7-2)12-13-25-20(24)17(5)14-18(21)15-26-19(23)16(3)4/h14,18H,3,6-13,15,21H2,1-2,4-5H3/t18-/m1/s1 |
| InChIKey | BYCKEKCPSCABCB-GOSISDBHSA-N |
| XLogP | 2.82 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|