C20H36N2O4 — CID 175331995
(4R)-4-amino-5-[5-(dibutylamino)-2-methylpent-2-enoyl]oxy-2-methylpent-2-enoic acid (PubChem CID 175331995) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is (4R)-4-amino-5-[5-(dibutylamino)-2-methylpent-2-enoyl]oxy-2-methylpent-2-enoic acid.
| Compound Name | (4R)-4-amino-5-[5-(dibutylamino)-2-methylpent-2-enoyl]oxy-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 175331995 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (4R)-4-amino-5-[5-(dibutylamino)-2-methylpent-2-enoyl]oxy-2-methylpent-2-enoic acid |
| SMILES | CCCCN(CCC=C(C)C(=O)OC[C@H](N)C=C(C)C(=O)O)CCCC |
| InChI | InChI=1S/C20H36N2O4/c1-5-7-11-22(12-8-6-2)13-9-10-16(3)20(25)26-15-18(21)14-17(4)19(23)24/h10,14,18H,5-9,11-13,15,21H2,1-4H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | CTLTYGFSWITEPI-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|