C18H33NO7Si — CID 174831331
4-(dimethylamino)-2-methyl-5-(2-methyl-6-trimethoxysilylhex-2-enoyl)oxypent-2-enoic acid (PubChem CID 174831331) has the molecular formula C18H33NO7Si and a molecular weight of 403.55 g/mol. Its IUPAC name is 4-(dimethylamino)-2-methyl-5-(2-methyl-6-trimethoxysilylhex-2-enoyl)oxypent-2-enoic acid.
| Compound Name | 4-(dimethylamino)-2-methyl-5-(2-methyl-6-trimethoxysilylhex-2-enoyl)oxypent-2-enoic acid |
|---|---|
| PubChem CID | 174831331 |
| Molecular Formula | C18H33NO7Si |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-(dimethylamino)-2-methyl-5-(2-methyl-6-trimethoxysilylhex-2-enoyl)oxypent-2-enoic acid |
| SMILES | CO[Si](CCCC=C(C)C(=O)OCC(C=C(C)C(=O)O)N(C)C)(OC)OC |
| InChI | InChI=1S/C18H33NO7Si/c1-14(10-8-9-11-27(23-5,24-6)25-7)18(22)26-13-16(19(3)4)12-15(2)17(20)21/h10,12,16H,8-9,11,13H2,1-7H3,(H,20,21) |
| InChIKey | KEOAWEZBYUHENU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|