C22H35NO6 — CID 175289147
7-(3-carboxybut-2-enoxycarbonyl)-4-(dimethylamino)-2,6-dimethyldodeca-2,6-dienoic acid (PubChem CID 175289147) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is 7-(3-carboxybut-2-enoxycarbonyl)-4-(dimethylamino)-2,6-dimethyldodeca-2,6-dienoic acid.
| Compound Name | 7-(3-carboxybut-2-enoxycarbonyl)-4-(dimethylamino)-2,6-dimethyldodeca-2,6-dienoic acid |
|---|---|
| PubChem CID | 175289147 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 7-(3-carboxybut-2-enoxycarbonyl)-4-(dimethylamino)-2,6-dimethyldodeca-2,6-dienoic acid |
| SMILES | CCCCCC(C(=O)OCC=C(C)C(=O)O)=C(C)CC(C=C(C)C(=O)O)N(C)C |
| InChI | InChI=1S/C22H35NO6/c1-7-8-9-10-19(22(28)29-12-11-15(2)20(24)25)16(3)13-18(23(5)6)14-17(4)21(26)27/h11,14,18H,7-10,12-13H2,1-6H3,(H,24,25)(H,26,27) |
| InChIKey | HOWUOYUGCGLKAB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|