C11H19NO3 — CID 171502645
2-[butyl(formyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 171502645) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[butyl(formyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[butyl(formyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171502645 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-[butyl(formyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C=O)CCCC |
| InChI | InChI=1S/C11H19NO3/c1-4-5-6-12(9-13)7-8-15-11(14)10(2)3/h9H,2,4-8H2,1,3H3 |
| InChIKey | PXRVYCDTJYHANH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|