About 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine
2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine (PubChem CID 135260346) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine |
| PubChem CID | 135260346 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine |
| SMILES | C=C(C)C(=O)OCCN(CC)CC.C=Cc1ccccn1 |
| InChI | InChI=1S/C10H19NO2.C7H7N/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-2-7-5-3-4-6-8-7/h3,5-8H2,1-2,4H3;2-6H,1H2 |
| InChIKey | ZODPNYWWSKHYAJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine?
The IUPAC name of 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine (CID 135260346) is 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine.
What is the SMILES notation for 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine?
The canonical SMILES for 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine is C=C(C)C(=O)OCCN(CC)CC.C=Cc1ccccn1.
What is the InChIKey of 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine?
The InChIKey is ZODPNYWWSKHYAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.C7H7N/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-2-7-5-3-4-6-8-7/h3,5-8H2,1-2,4H3;2-6H,1H2.
What are the key properties of 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine?
2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine has a molecular weight of 290.41 g/mol, XLogP of 3.17, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-methylprop-2-enoate;2-ethenylpyridine is sourced from PubChem (CID 135260346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).