C17H23N — CID 19427631
2-ethenylpyridine;bis(2-methylbuta-1,3-diene) (PubChem CID 19427631) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-ethenylpyridine;bis(2-methylbuta-1,3-diene).
| Compound Name | 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) |
|---|---|
| PubChem CID | 19427631 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) |
| SMILES | C=CC(=C)C.C=CC(=C)C.C=Cc1ccccn1 |
| InChI | InChI=1S/C7H7N.2C5H8/c1-2-7-5-3-4-6-8-7;2*1-4-5(2)3/h2-6H,1H2;2*4H,1-2H2,3H3 |
| InChIKey | BTGXDCCRHUOCIX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|