About 2-ethenylpyridine;bis(2-methylbuta-1,3-diene)
2-ethenylpyridine;bis(2-methylbuta-1,3-diene) (PubChem CID 19427631) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-ethenylpyridine;bis(2-methylbuta-1,3-diene).
Molecular Properties
| Compound Name | 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) |
| PubChem CID | 19427631 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) |
| SMILES | C=CC(=C)C.C=CC(=C)C.C=Cc1ccccn1 |
| InChI | InChI=1S/C7H7N.2C5H8/c1-2-7-5-3-4-6-8-7;2*1-4-5(2)3/h2-6H,1H2;2*4H,1-2H2,3H3 |
| InChIKey | BTGXDCCRHUOCIX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpyridine;bis(2-methylbuta-1,3-diene)?
The IUPAC name of 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) (CID 19427631) is 2-ethenylpyridine;bis(2-methylbuta-1,3-diene).
What is the SMILES notation for 2-ethenylpyridine;bis(2-methylbuta-1,3-diene)?
The canonical SMILES for 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) is C=CC(=C)C.C=CC(=C)C.C=Cc1ccccn1.
What is the InChIKey of 2-ethenylpyridine;bis(2-methylbuta-1,3-diene)?
The InChIKey is BTGXDCCRHUOCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.2C5H8/c1-2-7-5-3-4-6-8-7;2*1-4-5(2)3/h2-6H,1H2;2*4H,1-2H2,3H3.
What are the key properties of 2-ethenylpyridine;bis(2-methylbuta-1,3-diene)?
2-ethenylpyridine;bis(2-methylbuta-1,3-diene) has a molecular weight of 241.38 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpyridine;bis(2-methylbuta-1,3-diene) is sourced from PubChem (CID 19427631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).