About 2-ethenylpyridine;2-hydroxypropanoate
2-ethenylpyridine;2-hydroxypropanoate (PubChem CID 21427737) has the molecular formula C10H12NO3-
and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-ethenylpyridine;2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-ethenylpyridine;2-hydroxypropanoate |
| PubChem CID | 21427737 |
| Molecular Formula | C10H12NO3- |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-ethenylpyridine;2-hydroxypropanoate |
| SMILES | C=Cc1ccccn1.CC(O)C(=O)[O-] |
| InChI | InChI=1S/C7H7N.C3H6O3/c1-2-7-5-3-4-6-8-7;1-2(4)3(5)6/h2-6H,1H2;2,4H,1H3,(H,5,6)/p-1 |
| InChIKey | GPLWYWWQIFWGJB-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethenylpyridine;2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpyridine;2-hydroxypropanoate?
The IUPAC name of 2-ethenylpyridine;2-hydroxypropanoate (CID 21427737) is 2-ethenylpyridine;2-hydroxypropanoate.
What is the SMILES notation for 2-ethenylpyridine;2-hydroxypropanoate?
The canonical SMILES for 2-ethenylpyridine;2-hydroxypropanoate is C=Cc1ccccn1.CC(O)C(=O)[O-].
What is the InChIKey of 2-ethenylpyridine;2-hydroxypropanoate?
The InChIKey is GPLWYWWQIFWGJB-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7N.C3H6O3/c1-2-7-5-3-4-6-8-7;1-2(4)3(5)6/h2-6H,1H2;2,4H,1H3,(H,5,6)/p-1.
What are the key properties of 2-ethenylpyridine;2-hydroxypropanoate?
2-ethenylpyridine;2-hydroxypropanoate has a molecular weight of 194.21 g/mol, XLogP of -0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpyridine;2-hydroxypropanoate is sourced from PubChem (CID 21427737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).