C16H24N2O6 — CID 154988870
2-[3-[acetyl-[2-(prop-2-enoylamino)ethyl]amino]propanoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 154988870) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[3-[acetyl-[2-(prop-2-enoylamino)ethyl]amino]propanoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[acetyl-[2-(prop-2-enoylamino)ethyl]amino]propanoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154988870 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[3-[acetyl-[2-(prop-2-enoylamino)ethyl]amino]propanoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)NCCN(CCC(=O)OCCOC(=O)C(=C)C)C(C)=O |
| InChI | InChI=1S/C16H24N2O6/c1-5-14(20)17-7-9-18(13(4)19)8-6-15(21)23-10-11-24-16(22)12(2)3/h5H,1-2,6-11H2,3-4H3,(H,17,20) |
| InChIKey | KYUXNRSUAKXKKZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|