About 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate
2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate (PubChem CID 89274312) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate |
| PubChem CID | 89274312 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate |
| SMILES | C=C(O)CCC(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C11H16O5/c1-8(2)11(14)16-7-6-15-10(13)5-4-9(3)12/h12H,1,3-7H2,2H3 |
| InChIKey | LCXHSCVTQPQLOD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate (CID 89274312) is 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate is C=C(O)CCC(=O)OCCOC(=O)C(=C)C.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate?
The InChIKey is LCXHSCVTQPQLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-8(2)11(14)16-7-6-15-10(13)5-4-9(3)12/h12H,1,3-7H2,2H3.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate?
2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate has a molecular weight of 228.24 g/mol, XLogP of 1.50, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 4-hydroxypent-4-enoate is sourced from PubChem (CID 89274312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).