C10H14O7 — CID 87506668
4-[2-(2-methylprop-2-enoylperoxy)ethoxy]-4-oxobutanoic acid (PubChem CID 87506668) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is 4-[2-(2-methylprop-2-enoylperoxy)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-methylprop-2-enoylperoxy)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87506668 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-[2-(2-methylprop-2-enoylperoxy)ethoxy]-4-oxobutanoic acid |
| SMILES | C=C(C)C(=O)OOCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H14O7/c1-7(2)10(14)17-16-6-5-15-9(13)4-3-8(11)12/h1,3-6H2,2H3,(H,11,12) |
| InChIKey | IJNNBZSAGOYFQA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|