C20H28O10 — CID 118237282
bis[2-(2-methylprop-2-enoylperoxy)ethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 118237282) has the molecular formula C20H28O10 and a molecular weight of 428.43 g/mol. Its IUPAC name is bis[2-(2-methylprop-2-enoylperoxy)ethyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | bis[2-(2-methylprop-2-enoylperoxy)ethyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118237282 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | bis[2-(2-methylprop-2-enoylperoxy)ethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OOCCOC(=O)C1CCCCC1C(=O)OCCOOC(=O)C(=C)C |
| InChI | InChI=1S/C20H28O10/c1-13(2)17(21)29-27-11-9-25-19(23)15-7-5-6-8-16(15)20(24)26-10-12-28-30-18(22)14(3)4/h15-16H,1,3,5-12H2,2,4H3 |
| InChIKey | BRMNJYCEXQWERM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|