C46H72O16 — CID 158408213
1-O,4-O-ditert-butyl 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate;2-O,4-O-ditert-butyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate (PubChem CID 158408213) has the molecular formula C46H72O16 and a molecular weight of 881.07 g/mol. Its IUPAC name is 1-O,4-O-ditert-butyl 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate;2-O,4-O-ditert-butyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-ditert-butyl 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate;2-O,4-O-ditert-butyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 158408213 |
| Molecular Formula | C46H72O16 |
| Molecular Weight | 881.07 g/mol |
| Exact Mass | 880.48 |
| IUPAC Name | 1-O,4-O-ditert-butyl 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate;2-O,4-O-ditert-butyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)OC(C)(C)C)CCC1C(=O)OC(C)(C)C.C=C(C)C(=O)OCCOC(=O)C1CCC(C(=O)OC(C)(C)C)CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/2C23H36O8/c1-14(2)18(24)28-11-12-29-20(26)17-13-15(19(25)30-22(3,4)5)9-10-16(17)21(27)31-23(6,7)8;1-14(2)18(24)28-11-12-29-20(26)16-10-9-15(19(25)30-22(3,4)5)13-17(16)21(27)31-23(6,7)8/h2*15-17H,1,9-13H2,2-8H3 |
| InChIKey | GYYQZWBNOVUFHX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.07 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|