C25H29F11O8 — CID 118893815
1-O-(2,2,4,4,5,5,5-heptafluoropentyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2,2,4,4-tetrafluoropentyl) cyclohexane-1,2,4-tricarboxylate (PubChem CID 118893815) has the molecular formula C25H29F11O8 and a molecular weight of 666.48 g/mol. Its IUPAC name is 1-O-(2,2,4,4,5,5,5-heptafluoropentyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2,2,4,4-tetrafluoropentyl) cyclohexane-1,2,4-tricarboxylate.
| Compound Name | 1-O-(2,2,4,4,5,5,5-heptafluoropentyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2,2,4,4-tetrafluoropentyl) cyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 118893815 |
| Molecular Formula | C25H29F11O8 |
| Molecular Weight | 666.48 g/mol |
| Exact Mass | 666.17 |
| IUPAC Name | 1-O-(2,2,4,4,5,5,5-heptafluoropentyl) 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 4-O-(2,2,4,4-tetrafluoropentyl) cyclohexane-1,2,4-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)OCC(F)(F)CC(C)(F)F)CCC1C(=O)OCC(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H29F11O8/c1-13(2)17(37)41-6-7-42-20(40)16-8-14(18(38)43-11-22(28,29)9-21(3,26)27)4-5-15(16)19(39)44-12-23(30,31)10-24(32,33)25(34,35)36/h14-16H,1,4-12H2,2-3H3 |
| InChIKey | DMAHALSQUPQJGE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|