C23H22F14O8 — CID 130411650
2-O,4-O-bis(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate (PubChem CID 130411650) has the molecular formula C23H22F14O8 and a molecular weight of 692.39 g/mol. Its IUPAC name is 2-O,4-O-bis(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate.
| Compound Name | 2-O,4-O-bis(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 130411650 |
| Molecular Formula | C23H22F14O8 |
| Molecular Weight | 692.39 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | 2-O,4-O-bis(2,2,3,3,4,4,4-heptafluorobutyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,2,4-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CCC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)CC1C(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H22F14O8/c1-10(2)14(38)42-5-6-43-16(40)12-4-3-11(15(39)44-8-18(24,25)20(28,29)22(32,33)34)7-13(12)17(41)45-9-19(26,27)21(30,31)23(35,36)37/h11-13H,1,3-9H2,2H3 |
| InChIKey | AFLCDLHXKZFXMU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|