C13H18F2O7S — CID 58372235
1,1-difluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxyethanesulfonic acid (PubChem CID 58372235) has the molecular formula C13H18F2O7S and a molecular weight of 356.34 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 58372235 |
| Molecular Formula | C13H18F2O7S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1,1-difluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OCC(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C13H18F2O7S/c1-8(2)11(16)22-10-5-3-9(4-6-10)12(17)21-7-13(14,15)23(18,19)20/h9-10H,1,3-7H2,2H3,(H,18,19,20) |
| InChIKey | CGRCYEFMEFHFRP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|