C17H22F6O8S2 — CID 58193476
4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 58193476) has the molecular formula C17H22F6O8S2 and a molecular weight of 532.48 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58193476 |
| Molecular Formula | C17H22F6O8S2 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OC(C)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H22F6O8S2/c1-9(2)14(24)31-12-6-4-11(5-7-12)15(25)30-10(3)8-13(32(26,27)16(18,19)20)33(28,29)17(21,22)23/h10-13H,1,4-8H2,2-3H3 |
| InChIKey | OMXYILWYRAPAPD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|