C24H36O10 — CID 101466549
bis[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl] cyclohexane-1,4-dicarboxylate (PubChem CID 101466549) has the molecular formula C24H36O10 and a molecular weight of 484.54 g/mol. Its IUPAC name is bis[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101466549 |
| Molecular Formula | C24H36O10 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | bis[1-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(C)OC(=O)C1CCC(C(=O)OC(C)OCCOC(=O)C(=C)C)CC1 |
| InChI | InChI=1S/C24H36O10/c1-15(2)21(25)31-13-11-29-17(5)33-23(27)19-7-9-20(10-8-19)24(28)34-18(6)30-12-14-32-22(26)16(3)4/h17-20H,1,3,7-14H2,2,4-6H3 |
| InChIKey | HARQHPQHPFKUMX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|