C9H17N3O3 — CID 146337147
2-[1-(diaminomethylideneamino)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 146337147) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[1-(diaminomethylideneamino)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[1-(diaminomethylideneamino)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146337147 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-[1-(diaminomethylideneamino)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(C)N=C(N)N |
| InChI | InChI=1S/C9H17N3O3/c1-6(2)8(13)15-5-4-14-7(3)12-9(10)11/h7H,1,4-5H2,2-3H3,(H4,10,11,12) |
| InChIKey | WKUINUVHAFBHSU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|