C14H18F6O2 — CID 58819322
[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 58819322) has the molecular formula C14H18F6O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is [4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58819322 |
| Molecular Formula | C14H18F6O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(C(C)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F6O2/c1-8(2)11(21)22-10-6-4-9(5-7-10)12(3,13(15,16)17)14(18,19)20/h9-10H,1,4-7H2,2-3H3 |
| InChIKey | IYVJYHXQONSRTP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|