C20H33F3O4 — CID 129118474
[4-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cycloheptyl] 2-methylprop-2-enoate (PubChem CID 129118474) has the molecular formula C20H33F3O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [4-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cycloheptyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cycloheptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118474 |
| Molecular Formula | C20H33F3O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [4-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cycloheptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCC(C(CC)(CC)OCC(C)(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H33F3O4/c1-6-19(7-2,26-13-18(5,25)20(21,22)23)15-9-8-10-16(12-11-15)27-17(24)14(3)4/h15-16,25H,3,6-13H2,1-2,4-5H3 |
| InChIKey | VATHHGQXKYAUAN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|