C20H30F6O4 — CID 129118739
[5-ethyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclodecyl] 2-methylprop-2-enoate (PubChem CID 129118739) has the molecular formula C20H30F6O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is [5-ethyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclodecyl] 2-methylprop-2-enoate.
| Compound Name | [5-ethyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclodecyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118739 |
| Molecular Formula | C20H30F6O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [5-ethyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]cyclodecyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCCC(CC)(OCC(O)(C(F)(F)F)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C20H30F6O4/c1-4-17(29-13-18(28,19(21,22)23)20(24,25)26)11-7-5-6-9-15(10-8-12-17)30-16(27)14(2)3/h15,28H,2,4-13H2,1,3H3 |
| InChIKey | ZTXWIRJVUHXJGC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|