C14H26O4 — CID 174949119
butane-2,2-diol;cyclohexyl 2-methylprop-2-enoate (PubChem CID 174949119) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is butane-2,2-diol;cyclohexyl 2-methylprop-2-enoate.
| Compound Name | butane-2,2-diol;cyclohexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174949119 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | butane-2,2-diol;cyclohexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1.CCC(C)(O)O |
| InChI | InChI=1S/C10H16O2.C4H10O2/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-3-4(2,5)6/h9H,1,3-7H2,2H3;5-6H,3H2,1-2H3 |
| InChIKey | UNFITJSTSCYSNU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|