C22H36O6 — CID 174729608
tert-butyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 174729608) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is tert-butyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | tert-butyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174729608 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | tert-butyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)(C)C.C=C(C)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H16O2.C8H14O2.C4H6O2/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-6(2)7(9)10-8(3,4)5;1-3(2)4(5)6/h9H,1,3-7H2,2H3;1H2,2-5H3;1H2,2H3,(H,5,6) |
| InChIKey | SKWNOFVVKIFNOK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|