C14H23NO3 — CID 174857281
cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enamide (PubChem CID 174857281) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enamide.
| Compound Name | cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 174857281 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | cyclohexyl 2-methylprop-2-enoate;2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)OC1CCCCC1.C=C(C)C(N)=O |
| InChI | InChI=1S/C10H16O2.C4H7NO/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-3(2)4(5)6/h9H,1,3-7H2,2H3;1H2,2H3,(H2,5,6) |
| InChIKey | MHJVTUZWFWXDMA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|