C16H26O5 — CID 159401375
cyclohexyl 2-methylprop-2-enoate;2-methoxyethyl prop-2-enoate (PubChem CID 159401375) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is cyclohexyl 2-methylprop-2-enoate;2-methoxyethyl prop-2-enoate.
| Compound Name | cyclohexyl 2-methylprop-2-enoate;2-methoxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 159401375 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | cyclohexyl 2-methylprop-2-enoate;2-methoxyethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1.C=CC(=O)OCCOC |
| InChI | InChI=1S/C10H16O2.C6H10O3/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-3-6(7)9-5-4-8-2/h9H,1,3-7H2,2H3;3H,1,4-5H2,2H3 |
| InChIKey | LNJNZRBGERRZOI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|