C16H26O4 — CID 175472887
cyclopentyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate (PubChem CID 175472887) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is cyclopentyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate.
| Compound Name | cyclopentyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175472887 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | cyclopentyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)C.C=CC(=O)OC1CCCC1 |
| InChI | InChI=1S/C8H12O2.C8H14O2/c1-2-8(9)10-7-5-3-4-6-7;1-6(2)5-10-8(9)7(3)4/h2,7H,1,3-6H2;6H,3,5H2,1-2,4H3 |
| InChIKey | MANJSYQRZGDYQL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|