C15H23NO4 — CID 163917231
methyl 2-methylprop-2-enoate;2-methylpropyl prop-2-enoate;prop-2-enenitrile (PubChem CID 163917231) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;2-methylpropyl prop-2-enoate;prop-2-enenitrile.
| Compound Name | methyl 2-methylprop-2-enoate;2-methylpropyl prop-2-enoate;prop-2-enenitrile |
|---|---|
| PubChem CID | 163917231 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl 2-methylprop-2-enoate;2-methylpropyl prop-2-enoate;prop-2-enenitrile |
| SMILES | C=C(C)C(=O)OC.C=CC#N.C=CC(=O)OCC(C)C |
| InChI | InChI=1S/C7H12O2.C5H8O2.C3H3N/c1-4-7(8)9-5-6(2)3;1-4(2)5(6)7-3;1-2-3-4/h4,6H,1,5H2,2-3H3;1H2,2-3H3;2H,1H2 |
| InChIKey | QXHXMXSXQJNYSZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|