C15H22O6 — CID 87544432
methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid (PubChem CID 87544432) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid.
| Compound Name | methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87544432 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid |
| SMILES | C=C(C)C(=O)OC.C=C(C=CC(=O)O)C(=O)OCC(C)C |
| InChI | InChI=1S/C10H14O4.C5H8O2/c1-7(2)6-14-10(13)8(3)4-5-9(11)12;1-4(2)5(6)7-3/h4-5,7H,3,6H2,1-2H3,(H,11,12);1H2,2-3H3 |
| InChIKey | DKOJTSYUVURVGE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|